C23H25N7S3 — CID 55600333
5-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 55600333) has the molecular formula C23H25N7S3 and a molecular weight of 495.70 g/mol. Its IUPAC name is 5-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 5-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 55600333 |
| Molecular Formula | C23H25N7S3 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 5-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | c1cncc(-c2nnc3n2C(CSc2nnc(Cc4cccs4)n2C2CCCCC2)CS3)c1 |
| InChI | InChI=1S/C23H25N7S3/c1-2-7-17(8-3-1)29-20(12-19-9-5-11-31-19)25-27-22(29)32-14-18-15-33-23-28-26-21(30(18)23)16-6-4-10-24-13-16/h4-6,9-11,13,17-18H,1-3,7-8,12,14-15H2 |
| InChIKey | LQXKQLYZBIUVGT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |