C23H25N7OS2 — CID 55604320
5-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 55604320) has the molecular formula C23H25N7OS2 and a molecular weight of 479.64 g/mol. Its IUPAC name is 5-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 5-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 55604320 |
| Molecular Formula | C23H25N7OS2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 5-[[4-butyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-3-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | CCCCn1c(SCC2CSc3nnc(-c4cccnc4)n32)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25N7OS2/c1-3-4-12-29-20(16-7-9-19(31-2)10-8-16)25-27-22(29)32-14-18-15-33-23-28-26-21(30(18)23)17-6-5-11-24-13-17/h5-11,13,18H,3-4,12,14-15H2,1-2H3 |
| InChIKey | DAGJHLNYSVBKKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |