C19H17N5OS3 — CID 42891387
3-ethyl-2-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 42891387) has the molecular formula C19H17N5OS3 and a molecular weight of 427.58 g/mol. Its IUPAC name is 3-ethyl-2-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42891387 |
| Molecular Formula | C19H17N5OS3 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-ethyl-2-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(SCC2CSc3nnc(-c4ccccc4)n32)nc2ccsc2c1=O |
| InChI | InChI=1S/C19H17N5OS3/c1-2-23-17(25)15-14(8-9-26-15)20-18(23)27-10-13-11-28-19-22-21-16(24(13)19)12-6-4-3-5-7-12/h3-9,13H,2,10-11H2,1H3 |
| InChIKey | FBAUFYFVPDHJLH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |