C18H16N6OS3 — CID 33363330
3-ethyl-2-[[(5R)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 33363330) has the molecular formula C18H16N6OS3 and a molecular weight of 428.57 g/mol. Its IUPAC name is 3-ethyl-2-[[(5R)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-[[(5R)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 33363330 |
| Molecular Formula | C18H16N6OS3 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 3-ethyl-2-[[(5R)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(SC[C@@H]2CSc3nnc(-c4ccncc4)n32)nc2ccsc2c1=O |
| InChI | InChI=1S/C18H16N6OS3/c1-2-23-16(25)14-13(5-8-26-14)20-17(23)27-9-12-10-28-18-22-21-15(24(12)18)11-3-6-19-7-4-11/h3-8,12H,2,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | LQLFCNNJAJQJNW-GFCCVEGCSA-N |
| XLogP | 3.57 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |