C19H17N7S2 — CID 33275200
(5S)-5-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 33275200) has the molecular formula C19H17N7S2 and a molecular weight of 407.53 g/mol. Its IUPAC name is (5S)-5-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | (5S)-5-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 33275200 |
| Molecular Formula | C19H17N7S2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (5S)-5-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | Cc1ccccc1-n1cnnc1SC[C@H]1CSc2nnc(-c3ccncc3)n21 |
| InChI | InChI=1S/C19H17N7S2/c1-13-4-2-3-5-16(13)25-12-21-23-18(25)27-10-15-11-28-19-24-22-17(26(15)19)14-6-8-20-9-7-14/h2-9,12,15H,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | BWGSBDATVPBDOP-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |