C16H12N6O2S2 — CID 33279095
2-(furan-2-yl)-5-[[(5S)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 33279095) has the molecular formula C16H12N6O2S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[[(5S)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-[[(5S)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 33279095 |
| Molecular Formula | C16H12N6O2S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-(furan-2-yl)-5-[[(5S)-3-pyridin-4-yl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | c1coc(-c2nnc(SC[C@@H]3CSc4nnc(-c5ccncc5)n43)o2)c1 |
| InChI | InChI=1S/C16H12N6O2S2/c1-2-12(23-7-1)14-19-21-16(24-14)26-9-11-8-25-15-20-18-13(22(11)15)10-3-5-17-6-4-10/h1-7,11H,8-9H2/t11-/m0/s1 |
| InChIKey | VZHSBQJFQAFZDM-NSHDSACASA-N |
| XLogP | 3.42 |
| TPSA | 95.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |