C17H13N5O2S2 — CID 33279090
2-(furan-2-yl)-5-[[(5R)-3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 33279090) has the molecular formula C17H13N5O2S2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[[(5R)-3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-[[(5R)-3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 33279090 |
| Molecular Formula | C17H13N5O2S2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-(furan-2-yl)-5-[[(5R)-3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc3n2[C@@H](CSc2nnc(-c4ccco4)o2)CS3)cc1 |
| InChI | InChI=1S/C17H13N5O2S2/c1-2-5-11(6-3-1)14-18-20-16-22(14)12(9-25-16)10-26-17-21-19-15(24-17)13-7-4-8-23-13/h1-8,12H,9-10H2/t12-/m1/s1 |
| InChIKey | QCTDGBREIYXSEI-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |