C14H13N3O2S — CID 972621
1-(furan-2-ylmethyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea (PubChem CID 972621) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 972621 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
| SMILES | Cc1nc2ccc(NC(=O)NCc3ccco3)cc2s1 |
| InChI | InChI=1S/C14H13N3O2S/c1-9-16-12-5-4-10(7-13(12)20-9)17-14(18)15-8-11-3-2-6-19-11/h2-7H,8H2,1H3,(H2,15,17,18) |
| InChIKey | MKCGLNSUYNTNGK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |