C13H10N4OS — CID 972705
4-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]phenol (PubChem CID 972705) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 972705 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]phenol |
| SMILES | Oc1ccc(-c2csc(Nc3ncccn3)n2)cc1 |
| InChI | InChI=1S/C13H10N4OS/c18-10-4-2-9(3-5-10)11-8-19-13(16-11)17-12-14-6-1-7-15-12/h1-8,18H,(H,14,15,16,17) |
| InChIKey | UHBVWOBZRJFYHZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |