C15H13N3O2S — CID 751866
4-[2-[(4-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 751866) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-[2-[(4-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-[(4-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 751866 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[2-[(4-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Cc1ccnc(Nc2nc(-c3ccc(O)c(O)c3)cs2)c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-9-4-5-16-14(6-9)18-15-17-11(8-21-15)10-2-3-12(19)13(20)7-10/h2-8,19-20H,1H3,(H,16,17,18) |
| InChIKey | HXUKSDIMBGRFKV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|