C20H23N3O3 — CID 97274473
(3S)-1-N-[4-(3-methoxyphenyl)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 97274473) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3S)-1-N-[4-(3-methoxyphenyl)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[4-(3-methoxyphenyl)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97274473 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3S)-1-N-[4-(3-methoxyphenyl)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | COc1cccc(-c2ccc(NC(=O)N3CCC[C@H](C(N)=O)C3)cc2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-26-18-6-2-4-15(12-18)14-7-9-17(10-8-14)22-20(25)23-11-3-5-16(13-23)19(21)24/h2,4,6-10,12,16H,3,5,11,13H2,1H3,(H2,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | LGGTWOHFODBCLV-INIZCTEOSA-N |
| XLogP | 3.09 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |