C20H28N4O3 — CID 97276497
(9aS)-N-(3-cyclopentyloxyphenyl)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 97276497) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (9aS)-N-(3-cyclopentyloxyphenyl)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aS)-N-(3-cyclopentyloxyphenyl)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 97276497 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (9aS)-N-(3-cyclopentyloxyphenyl)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CN1CCN2CCN(C(=O)Nc3cccc(OC4CCCC4)c3)C[C@H]2C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-22-9-10-23-11-12-24(14-18(23)19(22)25)20(26)21-15-5-4-8-17(13-15)27-16-6-2-3-7-16/h4-5,8,13,16,18H,2-3,6-7,9-12,14H2,1H3,(H,21,26)/t18-/m0/s1 |
| InChIKey | NDNZHEYMVJSZMS-SFHVURJKSA-N |
| XLogP | 2.00 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |