C27H33F3N4O3 — CID 67082409
N-(3-cyclohexyloxyphenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide (PubChem CID 67082409) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-(3-cyclohexyloxyphenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide.
| Compound Name | N-(3-cyclohexyloxyphenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 67082409 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-(3-cyclohexyloxyphenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(OC2CCCCC2)c1)N1CC(N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C27H33F3N4O3/c28-27(29,30)37-24-11-9-21(10-12-24)32-13-15-33(16-14-32)22-18-34(19-22)26(35)31-20-5-4-8-25(17-20)36-23-6-2-1-3-7-23/h4-5,8-12,17,22-23H,1-3,6-7,13-16,18-19H2,(H,31,35) |
| InChIKey | LCJBCFRIDBHFSF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|