C21H21Cl2F3N4O2 — CID 23140162
N-(2,4-dichlorophenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide (PubChem CID 23140162) has the molecular formula C21H21Cl2F3N4O2 and a molecular weight of 489.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 23140162 |
| Molecular Formula | C21H21Cl2F3N4O2 |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]azetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)N1CC(N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C21H21Cl2F3N4O2/c22-14-1-6-19(18(23)11-14)27-20(31)30-12-16(13-30)29-9-7-28(8-10-29)15-2-4-17(5-3-15)32-21(24,25)26/h1-6,11,16H,7-10,12-13H2,(H,27,31) |
| InChIKey | UKSNCPUCJFWAPN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|