C19H21ClN4O2 — CID 97278092
(2S)-N-[2-chloro-5-(methylcarbamoyl)phenyl]-2-pyridin-2-ylpiperidine-1-carboxamide (PubChem CID 97278092) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is (2S)-N-[2-chloro-5-(methylcarbamoyl)phenyl]-2-pyridin-2-ylpiperidine-1-carboxamide.
| Compound Name | (2S)-N-[2-chloro-5-(methylcarbamoyl)phenyl]-2-pyridin-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97278092 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2S)-N-[2-chloro-5-(methylcarbamoyl)phenyl]-2-pyridin-2-ylpiperidine-1-carboxamide |
| SMILES | CNC(=O)c1ccc(Cl)c(NC(=O)N2CCCC[C@H]2c2ccccn2)c1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-21-18(25)13-8-9-14(20)16(12-13)23-19(26)24-11-5-3-7-17(24)15-6-2-4-10-22-15/h2,4,6,8-10,12,17H,3,5,7,11H2,1H3,(H,21,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | OUAVNXHCYNQWOP-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |