C17H22N4O4S — CID 97281167
3-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide (PubChem CID 97281167) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 3-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 97281167 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1cccc(C(=O)NCc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-3-14(11-22)21-26(24,25)16-6-4-5-13(7-16)17(23)20-10-15-9-18-12(2)8-19-15/h4-9,14,21-22H,3,10-11H2,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | HTFGRRJNVKIEIF-CQSZACIVSA-N |
| XLogP | 0.76 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |