C10H15I — CID 97289307
(2R,6S,7R)-7-(iodomethyl)-1,7-dimethyltricyclo[2.2.1.02,6]heptane (PubChem CID 97289307) has the molecular formula C10H15I and a molecular weight of 262.13 g/mol. Its IUPAC name is (2R,6S,7R)-7-(iodomethyl)-1,7-dimethyltricyclo[2.2.1.02,6]heptane.
| Compound Name | (2R,6S,7R)-7-(iodomethyl)-1,7-dimethyltricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 97289307 |
| Molecular Formula | C10H15I |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (2R,6S,7R)-7-(iodomethyl)-1,7-dimethyltricyclo[2.2.1.02,6]heptane |
| SMILES | CC12[C@@H]3CC(C[C@@H]31)[C@@]2(C)CI |
| InChI | InChI=1S/C10H15I/c1-9(5-11)6-3-7-8(4-6)10(7,9)2/h6-8H,3-5H2,1-2H3/t6?,7-,8+,9-,10?/m1/s1 |
| InChIKey | RJDHYCCOLQYKMF-XSJBAMTNSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|