C9H18N2O2 — CID 97305816
tert-butyl (E,2R)-2,5-diaminopent-3-enoate (PubChem CID 97305816) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is tert-butyl (E,2R)-2,5-diaminopent-3-enoate.
| Compound Name | tert-butyl (E,2R)-2,5-diaminopent-3-enoate |
|---|---|
| PubChem CID | 97305816 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | tert-butyl (E,2R)-2,5-diaminopent-3-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](N)/C=C/CN |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)7(11)5-4-6-10/h4-5,7H,6,10-11H2,1-3H3/b5-4+/t7-/m1/s1 |
| InChIKey | OJXHAMWSMUABAH-SMMXGFFBSA-N |
| XLogP | 0.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|