C14H16BrNO3 — CID 97309212
2-[(1R,2S,4R)-4-bromo-2-formamidocyclohexyl]benzoic acid (PubChem CID 97309212) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is 2-[(1R,2S,4R)-4-bromo-2-formamidocyclohexyl]benzoic acid.
| Compound Name | 2-[(1R,2S,4R)-4-bromo-2-formamidocyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 97309212 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-[(1R,2S,4R)-4-bromo-2-formamidocyclohexyl]benzoic acid |
| SMILES | O=CN[C@H]1C[C@H](Br)CC[C@@H]1c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H16BrNO3/c15-9-5-6-11(13(7-9)16-8-17)10-3-1-2-4-12(10)14(18)19/h1-4,8-9,11,13H,5-7H2,(H,16,17)(H,18,19)/t9-,11-,13+/m1/s1 |
| InChIKey | VEDPAZVQZGSTRJ-XWIASGKRSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|