C14H13N5O4 — CID 97327211
1-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethyl]-6-methylpyrazolo[4,5-d]pyridazin-7-one (PubChem CID 97327211) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethyl]-6-methylpyrazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethyl]-6-methylpyrazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 97327211 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[(2S)-2-hydroxy-2-(3-nitrophenyl)ethyl]-6-methylpyrazolo[4,5-d]pyridazin-7-one |
| SMILES | Cn1ncc2cnn(C[C@@H](O)c3cccc([N+](=O)[O-])c3)c2c1=O |
| InChI | InChI=1S/C14H13N5O4/c1-17-14(21)13-10(6-15-17)7-16-18(13)8-12(20)9-3-2-4-11(5-9)19(22)23/h2-7,12,20H,8H2,1H3/t12-/m1/s1 |
| InChIKey | VEWBKFJOQGZBTL-GFCCVEGCSA-N |
| XLogP | 0.77 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|