C20H19N3O2S — CID 97328141
(3aR,7aR)-1-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one (PubChem CID 97328141) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (3aR,7aR)-1-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one.
| Compound Name | (3aR,7aR)-1-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
|---|---|
| PubChem CID | 97328141 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (3aR,7aR)-1-(2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
| SMILES | Cc1nc(N2CC[C@@H]3CCOC(=O)[C@@H]32)c2cc(-c3ccccc3)sc2n1 |
| InChI | InChI=1S/C20H19N3O2S/c1-12-21-18(23-9-7-14-8-10-25-20(24)17(14)23)15-11-16(26-19(15)22-12)13-5-3-2-4-6-13/h2-6,11,14,17H,7-10H2,1H3/t14-,17-/m1/s1 |
| InChIKey | PDZKOBQAOUEIDL-RHSMWYFYSA-N |
| XLogP | 3.81 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |