C21H19N3O2 — CID 98874379
(3aR,7aS)-1-(4-phenylquinazolin-2-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one (PubChem CID 98874379) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (3aR,7aS)-1-(4-phenylquinazolin-2-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one.
| Compound Name | (3aR,7aS)-1-(4-phenylquinazolin-2-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
|---|---|
| PubChem CID | 98874379 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (3aR,7aS)-1-(4-phenylquinazolin-2-yl)-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
| SMILES | O=C1OCC[C@H]2CCN(c3nc(-c4ccccc4)c4ccccc4n3)[C@H]12 |
| InChI | InChI=1S/C21H19N3O2/c25-20-19-15(11-13-26-20)10-12-24(19)21-22-17-9-5-4-8-16(17)18(23-21)14-6-2-1-3-7-14/h1-9,15,19H,10-13H2/t15-,19+/m1/s1 |
| InChIKey | QAAPMNRMYDOKAG-BEFAXECRSA-N |
| XLogP | 3.44 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |