C16H14F2N2O3 — CID 97328706
1-(4-ethynyl-2,6-difluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]urea (PubChem CID 97328706) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-(4-ethynyl-2,6-difluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]urea.
| Compound Name | 1-(4-ethynyl-2,6-difluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 97328706 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(4-ethynyl-2,6-difluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]urea |
| SMILES | C#Cc1cc(F)c(NC(=O)NC[C@](C)(O)c2ccco2)c(F)c1 |
| InChI | InChI=1S/C16H14F2N2O3/c1-3-10-7-11(17)14(12(18)8-10)20-15(21)19-9-16(2,22)13-5-4-6-23-13/h1,4-8,22H,9H2,2H3,(H2,19,20,21)/t16-/m0/s1 |
| InChIKey | PRGCFQIWPHVMOC-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|