C16H20N2O3S — CID 84584978
1-(3-ethylsulfanylphenyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]urea (PubChem CID 84584978) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-(3-ethylsulfanylphenyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]urea.
| Compound Name | 1-(3-ethylsulfanylphenyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 84584978 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-(3-ethylsulfanylphenyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]urea |
| SMILES | CCSc1cccc(NC(=O)NCC(C)(O)c2ccco2)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-3-22-13-7-4-6-12(10-13)18-15(19)17-11-16(2,20)14-8-5-9-21-14/h4-10,20H,3,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | QXEDPJIWLXPHFA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |