C18H27NO2S — CID 97330041
4-hydroxy-N-[(1S)-3-methyl-1-(2-methylphenyl)butyl]thiane-4-carboxamide (PubChem CID 97330041) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 4-hydroxy-N-[(1S)-3-methyl-1-(2-methylphenyl)butyl]thiane-4-carboxamide.
| Compound Name | 4-hydroxy-N-[(1S)-3-methyl-1-(2-methylphenyl)butyl]thiane-4-carboxamide |
|---|---|
| PubChem CID | 97330041 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-hydroxy-N-[(1S)-3-methyl-1-(2-methylphenyl)butyl]thiane-4-carboxamide |
| SMILES | Cc1ccccc1[C@H](CC(C)C)NC(=O)C1(O)CCSCC1 |
| InChI | InChI=1S/C18H27NO2S/c1-13(2)12-16(15-7-5-4-6-14(15)3)19-17(20)18(21)8-10-22-11-9-18/h4-7,13,16,21H,8-12H2,1-3H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | PYVTVFAUHQYOMW-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |