C24H26F2N2O4 — CID 97330374
2-[(1R,3S)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]cyclohexyl]isoindole-1,3-dione (PubChem CID 97330374) has the molecular formula C24H26F2N2O4 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[(1R,3S)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,3S)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 97330374 |
| Molecular Formula | C24H26F2N2O4 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[(1R,3S)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]cyclohexyl]isoindole-1,3-dione |
| SMILES | COc1cc(CCN[C@H]2CCC[C@@H](N3C(=O)c4ccccc4C3=O)C2)ccc1OC(F)F |
| InChI | InChI=1S/C24H26F2N2O4/c1-31-21-13-15(9-10-20(21)32-24(25)26)11-12-27-16-5-4-6-17(14-16)28-22(29)18-7-2-3-8-19(18)23(28)30/h2-3,7-10,13,16-17,24,27H,4-6,11-12,14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | HTPBSFQAHGRHER-DLBZAZTESA-N |
| XLogP | 4.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|