C17H15F3N6O — CID 97339637
(7R)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 97339637) has the molecular formula C17H15F3N6O and a molecular weight of 376.34 g/mol. Its IUPAC name is (7R)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | (7R)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 97339637 |
| Molecular Formula | C17H15F3N6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (7R)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ncn[nH]2)cc1)[C@@H]1CCn2c(cnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H15F3N6O/c18-17(19,20)16-21-8-13-7-11(5-6-26(13)16)15(27)24-12-3-1-10(2-4-12)14-22-9-23-25-14/h1-4,8-9,11H,5-7H2,(H,24,27)(H,22,23,25)/t11-/m1/s1 |
| InChIKey | NRXBPQVYAKFZAF-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |