C16H22N2O2S — CID 97340334
N-[(R)-(4-tert-butylphenyl)-cyanomethyl]-3-[(S)-methylsulfinyl]propanamide (PubChem CID 97340334) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[(R)-(4-tert-butylphenyl)-cyanomethyl]-3-[(S)-methylsulfinyl]propanamide.
| Compound Name | N-[(R)-(4-tert-butylphenyl)-cyanomethyl]-3-[(S)-methylsulfinyl]propanamide |
|---|---|
| PubChem CID | 97340334 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[(R)-(4-tert-butylphenyl)-cyanomethyl]-3-[(S)-methylsulfinyl]propanamide |
| SMILES | C[S@](=O)CCC(=O)N[C@@H](C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O2S/c1-16(2,3)13-7-5-12(6-8-13)14(11-17)18-15(19)9-10-21(4)20/h5-8,14H,9-10H2,1-4H3,(H,18,19)/t14-,21-/m0/s1 |
| InChIKey | DPXUEMXNCYBQKW-QKKBWIMNSA-N |
| XLogP | 2.43 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |