C11H15F3N2O4 — CID 97347699
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-oxo-3-(2,2,2-trifluoroethylamino)propanoate (PubChem CID 97347699) has the molecular formula C11H15F3N2O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-oxo-3-(2,2,2-trifluoroethylamino)propanoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-oxo-3-(2,2,2-trifluoroethylamino)propanoate |
|---|---|
| PubChem CID | 97347699 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-oxo-3-(2,2,2-trifluoroethylamino)propanoate |
| SMILES | C[C@@H](OC(=O)CC(=O)NCC(F)(F)F)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H15F3N2O4/c1-6(10(19)16-7-2-3-7)20-9(18)4-8(17)15-5-11(12,13)14/h6-7H,2-5H2,1H3,(H,15,17)(H,16,19)/t6-/m1/s1 |
| InChIKey | PBAUDSNPAJUPLA-ZCFIWIBFSA-N |
| XLogP | 0.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|