C18H27N3O4S — CID 97348373
(3S)-1-(cyclopentanecarbonyl)-N-[(2-methoxy-4-pyridinyl)methyl]piperidine-3-sulfonamide (PubChem CID 97348373) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is (3S)-1-(cyclopentanecarbonyl)-N-[(2-methoxy-4-pyridinyl)methyl]piperidine-3-sulfonamide.
| Compound Name | (3S)-1-(cyclopentanecarbonyl)-N-[(2-methoxy-4-pyridinyl)methyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348373 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3S)-1-(cyclopentanecarbonyl)-N-[(2-methoxy-4-pyridinyl)methyl]piperidine-3-sulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)[C@H]2CCCN(C(=O)C3CCCC3)C2)ccn1 |
| InChI | InChI=1S/C18H27N3O4S/c1-25-17-11-14(8-9-19-17)12-20-26(23,24)16-7-4-10-21(13-16)18(22)15-5-2-3-6-15/h8-9,11,15-16,20H,2-7,10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | HOKVGDJLXQLRSP-INIZCTEOSA-N |
| XLogP | 1.69 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |