C20H27ClN2O4 — CID 97349350
1-(3-chloro-4-cyclopentyloxyphenyl)-3-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]urea (PubChem CID 97349350) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is 1-(3-chloro-4-cyclopentyloxyphenyl)-3-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]urea.
| Compound Name | 1-(3-chloro-4-cyclopentyloxyphenyl)-3-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]urea |
|---|---|
| PubChem CID | 97349350 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-(3-chloro-4-cyclopentyloxyphenyl)-3-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]urea |
| SMILES | O=C(Nc1ccc(OC2CCCC2)c(Cl)c1)N[C@@H]1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C20H27ClN2O4/c21-17-12-14(7-8-18(17)27-16-5-1-2-6-16)22-19(24)23-15-4-3-9-20(13-15)25-10-11-26-20/h7-8,12,15-16H,1-6,9-11,13H2,(H2,22,23,24)/t15-/m1/s1 |
| InChIKey | NPLZGDVJVKFNLF-OAHLLOKOSA-N |
| XLogP | 4.47 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |