C17H21ClN4O2 — CID 71886636
1-(3-chloro-4-cyclopentyloxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)urea (PubChem CID 71886636) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(3-chloro-4-cyclopentyloxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)urea.
| Compound Name | 1-(3-chloro-4-cyclopentyloxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 71886636 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(3-chloro-4-cyclopentyloxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(OC3CCCC3)c(Cl)c2)n(C)n1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-11-9-16(22(2)21-11)20-17(23)19-12-7-8-15(14(18)10-12)24-13-5-3-4-6-13/h7-10,13H,3-6H2,1-2H3,(H2,19,20,23) |
| InChIKey | OKIKHTCWJKMRIT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |