C17H20ClN3O3 — CID 124877193
(2S)-N-(3-chloro-4-cyclopentyloxyphenyl)-2-hydroxy-2-(1-methylpyrazol-4-yl)acetamide (PubChem CID 124877193) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-cyclopentyloxyphenyl)-2-hydroxy-2-(1-methylpyrazol-4-yl)acetamide.
| Compound Name | (2S)-N-(3-chloro-4-cyclopentyloxyphenyl)-2-hydroxy-2-(1-methylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 124877193 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2S)-N-(3-chloro-4-cyclopentyloxyphenyl)-2-hydroxy-2-(1-methylpyrazol-4-yl)acetamide |
| SMILES | Cn1cc([C@H](O)C(=O)Nc2ccc(OC3CCCC3)c(Cl)c2)cn1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-21-10-11(9-19-21)16(22)17(23)20-12-6-7-15(14(18)8-12)24-13-4-2-3-5-13/h6-10,13,16,22H,2-5H2,1H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | DTFJPMIJAFTIPM-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |