C20H27ClN2O4 — CID 95161860
N-(3-chloro-4-cyclopentyloxyphenyl)-2-oxo-2-[(6R)-2,2,6-trimethylmorpholin-4-yl]acetamide (PubChem CID 95161860) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-(3-chloro-4-cyclopentyloxyphenyl)-2-oxo-2-[(6R)-2,2,6-trimethylmorpholin-4-yl]acetamide.
| Compound Name | N-(3-chloro-4-cyclopentyloxyphenyl)-2-oxo-2-[(6R)-2,2,6-trimethylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 95161860 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-(3-chloro-4-cyclopentyloxyphenyl)-2-oxo-2-[(6R)-2,2,6-trimethylmorpholin-4-yl]acetamide |
| SMILES | C[C@@H]1CN(C(=O)C(=O)Nc2ccc(OC3CCCC3)c(Cl)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C20H27ClN2O4/c1-13-11-23(12-20(2,3)27-13)19(25)18(24)22-14-8-9-17(16(21)10-14)26-15-6-4-5-7-15/h8-10,13,15H,4-7,11-12H2,1-3H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | XBSSAUUXGAAYCS-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|