C19H25FN2O3 — CID 99789621
N-(4-cyclobutyloxy-3-fluorophenyl)-2-oxo-2-(2,2,3,3-tetramethylazetidin-1-yl)acetamide (PubChem CID 99789621) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(4-cyclobutyloxy-3-fluorophenyl)-2-oxo-2-(2,2,3,3-tetramethylazetidin-1-yl)acetamide.
| Compound Name | N-(4-cyclobutyloxy-3-fluorophenyl)-2-oxo-2-(2,2,3,3-tetramethylazetidin-1-yl)acetamide |
|---|---|
| PubChem CID | 99789621 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(4-cyclobutyloxy-3-fluorophenyl)-2-oxo-2-(2,2,3,3-tetramethylazetidin-1-yl)acetamide |
| SMILES | CC1(C)CN(C(=O)C(=O)Nc2ccc(OC3CCC3)c(F)c2)C1(C)C |
| InChI | InChI=1S/C19H25FN2O3/c1-18(2)11-22(19(18,3)4)17(24)16(23)21-12-8-9-15(14(20)10-12)25-13-6-5-7-13/h8-10,13H,5-7,11H2,1-4H3,(H,21,23) |
| InChIKey | WMHNTXAVUQYBMF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|