C15H16F3NO2S — CID 97350653
[(3aS,4S,6aR)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone (PubChem CID 97350653) has the molecular formula C15H16F3NO2S and a molecular weight of 331.36 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone.
| Compound Name | [(3aS,4S,6aR)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 97350653 |
| Molecular Formula | C15H16F3NO2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [(3aS,4S,6aR)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccc(SC(F)(F)F)cc1)N1C[C@@H]2CC[C@H](O)[C@@H]2C1 |
| InChI | InChI=1S/C15H16F3NO2S/c16-15(17,18)22-11-4-1-9(2-5-11)14(21)19-7-10-3-6-13(20)12(10)8-19/h1-2,4-5,10,12-13,20H,3,6-8H2/t10-,12+,13-/m0/s1 |
| InChIKey | UOGPNBKSSDPDBE-UHTWSYAYSA-N |
| XLogP | 3.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |