C15H16N4O3 — CID 97359464
methyl 2-[3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]-1,2,4-triazol-1-yl]acetate (PubChem CID 97359464) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is methyl 2-[3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]-1,2,4-triazol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 97359464 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 2-[3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]-1,2,4-triazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cnc(NC(=O)/C=C\c2cccc(C)c2)n1 |
| InChI | InChI=1S/C15H16N4O3/c1-11-4-3-5-12(8-11)6-7-13(20)17-15-16-10-19(18-15)9-14(21)22-2/h3-8,10H,9H2,1-2H3,(H,17,18,20)/b7-6- |
| InChIKey | NGFMABWKYYSPHH-SREVYHEPSA-N |
| XLogP | 1.41 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|