C17H14N4OS — CID 97359898
(Z)-N-[4-(4-methylpyrimidin-2-yl)phenyl]-3-(1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 97359898) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is (Z)-N-[4-(4-methylpyrimidin-2-yl)phenyl]-3-(1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N-[4-(4-methylpyrimidin-2-yl)phenyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 97359898 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (Z)-N-[4-(4-methylpyrimidin-2-yl)phenyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccnc(-c2ccc(NC(=O)/C=C\c3cscn3)cc2)n1 |
| InChI | InChI=1S/C17H14N4OS/c1-12-8-9-18-17(20-12)13-2-4-14(5-3-13)21-16(22)7-6-15-10-23-11-19-15/h2-11H,1H3,(H,21,22)/b7-6- |
| InChIKey | AEYGQYCLEVWQGX-SREVYHEPSA-N |
| XLogP | 3.56 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|