C7H8N2O2S — CID 131247757
(E)-N-methoxy-3-(1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 131247757) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is (E)-N-methoxy-3-(1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-methoxy-3-(1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 131247757 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (E)-N-methoxy-3-(1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CONC(=O)/C=C/c1cscn1 |
| InChI | InChI=1S/C7H8N2O2S/c1-11-9-7(10)3-2-6-4-12-5-8-6/h2-5H,1H3,(H,9,10)/b3-2+ |
| InChIKey | VZVWBHGDYZWMAY-NSCUHMNNSA-N |
| XLogP | 0.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|