C17H19N3OS2 — CID 71881303
3-(1,3-thiazol-4-yl)-N-[(4-thiomorpholin-4-ylphenyl)methyl]prop-2-enamide (PubChem CID 71881303) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-yl)-N-[(4-thiomorpholin-4-ylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(1,3-thiazol-4-yl)-N-[(4-thiomorpholin-4-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71881303 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-(1,3-thiazol-4-yl)-N-[(4-thiomorpholin-4-ylphenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cscn1)NCc1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H19N3OS2/c21-17(6-3-15-12-23-13-19-15)18-11-14-1-4-16(5-2-14)20-7-9-22-10-8-20/h1-6,12-13H,7-11H2,(H,18,21) |
| InChIKey | RLJVQAZNMBDIFR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|