C24H18FN5O — CID 97362018
N-(2-fluoro-4-methylphenyl)-2-(6-pyridin-3-ylindolizin-3-yl)pyrazole-3-carboxamide (PubChem CID 97362018) has the molecular formula C24H18FN5O and a molecular weight of 411.44 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-(6-pyridin-3-ylindolizin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-(6-pyridin-3-ylindolizin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97362018 |
| Molecular Formula | C24H18FN5O |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-(6-pyridin-3-ylindolizin-3-yl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnn2-c2ccc3ccc(-c4cccnc4)cn23)c(F)c1 |
| InChI | InChI=1S/C24H18FN5O/c1-16-4-8-21(20(25)13-16)28-24(31)22-10-12-27-30(22)23-9-7-19-6-5-18(15-29(19)23)17-3-2-11-26-14-17/h2-15H,1H3,(H,28,31) |
| InChIKey | DMOVVQOVJGPYKT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |