C20H31NO4 — CID 97363155
(4aR,8aS)-6-[2-(3,4-dimethoxyphenyl)ethyl]-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 97363155) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (4aR,8aS)-6-[2-(3,4-dimethoxyphenyl)ethyl]-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aR,8aS)-6-[2-(3,4-dimethoxyphenyl)ethyl]-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 97363155 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (4aR,8aS)-6-[2-(3,4-dimethoxyphenyl)ethyl]-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | COC[C@]12CCCO[C@H]1CCN(CCc1ccc(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C20H31NO4/c1-22-15-20-9-4-12-25-19(20)8-11-21(14-20)10-7-16-5-6-17(23-2)18(13-16)24-3/h5-6,13,19H,4,7-12,14-15H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | LVPJSJSMPHZSRT-VQTJNVASSA-N |
| XLogP | 2.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |