C12H21N3O3 — CID 97366943
(2R,3aS,7aR)-2-N,6-N,6-N-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2,6-dicarboxamide (PubChem CID 97366943) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2R,3aS,7aR)-2-N,6-N,6-N-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2,6-dicarboxamide.
| Compound Name | (2R,3aS,7aR)-2-N,6-N,6-N-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 97366943 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2R,3aS,7aR)-2-N,6-N,6-N-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CCN(C(=O)N(C)C)C[C@@H]2O1 |
| InChI | InChI=1S/C12H21N3O3/c1-13-11(16)9-6-8-4-5-15(7-10(8)18-9)12(17)14(2)3/h8-10H,4-7H2,1-3H3,(H,13,16)/t8-,9+,10-/m0/s1 |
| InChIKey | SNIXJIKGJAODDJ-AEJSXWLSSA-N |
| XLogP | -0.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |