C19H28N4O2 — CID 97367059
(4R,4aR,8aR)-N-cyclopentyl-6-(6-methylpyridazin-3-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 97367059) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (4R,4aR,8aR)-N-cyclopentyl-6-(6-methylpyridazin-3-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aR,8aR)-N-cyclopentyl-6-(6-methylpyridazin-3-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97367059 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (4R,4aR,8aR)-N-cyclopentyl-6-(6-methylpyridazin-3-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | Cc1ccc(N2CC[C@H]3OCC[C@@H](C(=O)NC4CCCC4)[C@@H]3C2)nn1 |
| InChI | InChI=1S/C19H28N4O2/c1-13-6-7-18(22-21-13)23-10-8-17-16(12-23)15(9-11-25-17)19(24)20-14-4-2-3-5-14/h6-7,14-17H,2-5,8-12H2,1H3,(H,20,24)/t15-,16+,17-/m1/s1 |
| InChIKey | KTLHOXWIXJJHGX-IXDOHACOSA-N |
| XLogP | 2.08 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |