C18H22N2OS — CID 97371135
(3R)-3-pyridin-3-yl-8-(thiophen-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97371135) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (3R)-3-pyridin-3-yl-8-(thiophen-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3-pyridin-3-yl-8-(thiophen-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97371135 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (3R)-3-pyridin-3-yl-8-(thiophen-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | c1cncc([C@@H]2COC3(CCN(Cc4ccsc4)CC3)C2)c1 |
| InChI | InChI=1S/C18H22N2OS/c1-2-16(11-19-6-1)17-10-18(21-13-17)4-7-20(8-5-18)12-15-3-9-22-14-15/h1-3,6,9,11,14,17H,4-5,7-8,10,12-13H2/t17-/m0/s1 |
| InChIKey | PAPVCEXCIDQGMB-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |