C21H26N2O2 — CID 118745893
8-[(4-methoxyphenyl)methyl]-3-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 118745893) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methyl]-3-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 8-[(4-methoxyphenyl)methyl]-3-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 118745893 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 8-[(4-methoxyphenyl)methyl]-3-pyridin-3-yl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | COc1ccc(CN2CCC3(CC2)CC(c2cccnc2)CO3)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-24-20-6-4-17(5-7-20)15-23-11-8-21(9-12-23)13-19(16-25-21)18-3-2-10-22-14-18/h2-7,10,14,19H,8-9,11-13,15-16H2,1H3 |
| InChIKey | NJTYZCJSKBPFRT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |