C18H21N3O — CID 97394818
(3R)-3,8-dipyridin-3-yl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97394818) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (3R)-3,8-dipyridin-3-yl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3,8-dipyridin-3-yl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97394818 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (3R)-3,8-dipyridin-3-yl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | c1cncc([C@@H]2COC3(CCN(c4cccnc4)CC3)C2)c1 |
| InChI | InChI=1S/C18H21N3O/c1-3-15(12-19-7-1)16-11-18(22-14-16)5-9-21(10-6-18)17-4-2-8-20-13-17/h1-4,7-8,12-13,16H,5-6,9-11,14H2/t16-/m0/s1 |
| InChIKey | YVWFJEHLWUJTFS-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |