C11H16N2O2 — CID 97377692
[(3aS,6aS)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazol-5-yl]-cyclopent-3-en-1-ylmethanone (PubChem CID 97377692) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(3aS,6aS)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazol-5-yl]-cyclopent-3-en-1-ylmethanone.
| Compound Name | [(3aS,6aS)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazol-5-yl]-cyclopent-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 97377692 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [(3aS,6aS)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazol-5-yl]-cyclopent-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CC1)N1C[C@@H]2CON[C@@H]2C1 |
| InChI | InChI=1S/C11H16N2O2/c14-11(8-3-1-2-4-8)13-5-9-7-15-12-10(9)6-13/h1-2,8-10,12H,3-7H2/t9-,10-/m1/s1 |
| InChIKey | ZKFAPQIUTBAEOJ-NXEZZACHSA-N |
| XLogP | 0.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|