C14H18N2O3S2 — CID 97378563
[(3aS,6aR)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone (PubChem CID 97378563) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is [(3aS,6aR)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3aS,6aR)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 97378563 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | [(3aS,6aR)-4-cyclopropylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CC[C@H]2[C@H]1CCN2S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H18N2O3S2/c17-14(10-5-8-20-9-10)15-6-3-13-12(15)4-7-16(13)21(18,19)11-1-2-11/h5,8-9,11-13H,1-4,6-7H2/t12-,13+/m1/s1 |
| InChIKey | CEQQHWQYUFYBFP-OLZOCXBDSA-N |
| XLogP | 1.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |