C15H18N2O5S — CID 97459065
[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 97459065) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is [(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 97459065 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H]1CCN2C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18N2O5S/c1-23(19,20)17-7-5-11-12(17)4-6-16(11)15(18)10-2-3-13-14(8-10)22-9-21-13/h2-3,8,11-12H,4-7,9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | JKZPBOLZVYSTPH-NEPJUHHUSA-N |
| XLogP | 0.66 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |